EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35NO2 |
| Net Charge | 0 |
| Average Mass | 321.505 |
| Monoisotopic Mass | 321.26678 |
| SMILES | CCCCCCCCCCC[C@@H](O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C20H35NO2/c1-2-3-4-5-6-7-8-9-10-11-20(23)19(21)16-17-12-14-18(22)15-13-17/h12-15,19-20,22-23H,2-11,16,21H2,1H3/t19-,20+/m0/s1 |
| InChIKey | MPISMXPJOKVYGA-VQTJNVASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vibriospecies QWI-06 (ncbitaxon:1638654) | - | PubMed (26238555) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vitroprocine C (CHEBI:227443) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| 4-[(2S,3R)-2-amino-3-hydroxytetradecyl]phenol |
| Manual Xrefs | Databases |
|---|---|
| 40256818 | ChemSpider |