EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O5 |
| Net Charge | 0 |
| Average Mass | 210.185 |
| Monoisotopic Mass | 210.05282 |
| SMILES | O=C1O[C@H](CO)Cc2c(O)ccc(O)c21 |
| InChI | InChI=1S/C10H10O5/c11-4-5-3-6-7(12)1-2-8(13)9(6)10(14)15-5/h1-2,5,11-13H,3-4H2/t5-/m0/s1 |
| InChIKey | ZWUDMMSALBLKBH-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botryosphaeriaspecies (ncbitaxon:1869280) | - | PubMed (25966851) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Botryoisocoumarin A (CHEBI:227407) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3S)-5,8-dihydroxy-3-(hydroxymethyl)-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 40256653 | ChemSpider |