EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H44O9 |
| Net Charge | 0 |
| Average Mass | 560.684 |
| Monoisotopic Mass | 560.29853 |
| SMILES | COC(=O)[C@@H](C)CC(=O)C[C@](C)(O)C1=C[C@@H](O)[C@]2(C)[C@]1(C)C(=O)C=C1[C@@]2(O)C(=O)C[C@H]2C(C)(C)[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C31H44O9/c1-16(25(37)40-8)11-17(32)15-28(5,38)20-14-23(35)30(7)29(20,6)22(34)13-19-27(4)10-9-21(33)26(2,3)18(27)12-24(36)31(19,30)39/h13-14,16,18,21,23,33,35,38-39H,9-12,15H2,1-8H3/t16-,18-,21-,23+,27-,28-,29-,30+,31+/m0/s1 |
| InChIKey | BFDKCDVOVGIDSB-CLNHIPMDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma applanatum (ncbitaxon:29884) | - | PubMed (30390604) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl applaniate A (CHEBI:227399) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| methyl (2S,6S)-6-hydroxy-2-methyl-4-oxo-6-[(3S,5R,8S,10S,13R,14S,15R)-3,8,15-trihydroxy-4,4,10,13,14-pentamethyl-7,12-dioxo-1,2,3,5,6,15-hexahydrocyclopenta[a]phenanthren-17-yl]heptanoate |