EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H28O11 |
| Net Charge | 0 |
| Average Mass | 576.554 |
| Monoisotopic Mass | 576.16316 |
| SMILES | COCC(O)C(O)C(O)C(O)=c1c(C)cc2c(c(O)c3c(=O)cc(C)c4c5ccc(=C(C)O)c(=O)c5c(O)c2c34)c1=O |
| InChI | InChI=1S/C31H28O11/c1-10-7-15-20-24-18(14-6-5-13(12(3)32)25(35)21(14)28(20)38)11(2)8-16(33)23(24)29(39)22(15)27(37)19(10)30(40)31(41)26(36)17(34)9-42-4/h5-8,17,26,31-32,34,36,38-41H,9H2,1-4H3 |
| InChIKey | ILBUMWPMBSLENO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clostridium puniceum (ncbitaxon:29367) | - | PubMed (26542569) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Clostrubin B (CHEBI:227398) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| 8,20-dihydroxy-17-(1-hydroxyethylidene)-4,12-dimethyl-5-(1,2,3,4-tetrahydroxy-5-methoxypentylidene)pentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1,3,7,9(21),11,13,15,19-octaene-6,10,18-trione |
| Manual Xrefs | Databases |
|---|---|
| 78444524 | ChemSpider |