EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H41N9O10 |
| Net Charge | 0 |
| Average Mass | 711.733 |
| Monoisotopic Mass | 711.29764 |
| SMILES | CC(N)C(=O)N(C)C(C)C(NC(=O)C(C)NC(=O)NC(Cc1cnc2ccccc12)C(=O)O)C(=O)N/C=C1/CC(O)C(n2ccc(=O)nc2=O)O1 |
| InChI | InChI=1S/C32H41N9O10/c1-15(33)28(46)40(4)17(3)25(27(45)35-14-19-12-23(42)29(51-19)41-10-9-24(43)38-32(41)50)39-26(44)16(2)36-31(49)37-22(30(47)48)11-18-13-34-21-8-6-5-7-20(18)21/h5-10,13-17,22-23,25,29,34,42H,11-12,33H2,1-4H3,(H,35,45)(H,39,44)(H,47,48)(H2,36,37,49)(H,38,43,50)/b19-14- |
| InChIKey | PBFVZISIBPPZNE-RGEXLXHISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces coeruleorubidus (ncbitaxon:116188) | - | PubMed (11217807) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pacidamycin D (CHEBI:227355) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[[1-[[3-[2-aminopropanoyl(methyl)amino]-1-[[(Z)-[5-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-ylidene]methyl]amino]-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]carbamoylamino]-3-(1H-indol-3-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8115649 | ChemSpider |