EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38N4O5 |
| Net Charge | 0 |
| Average Mass | 510.635 |
| Monoisotopic Mass | 510.28422 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H38N4O5/c1-17(2)23(26(34)30-22(28(36)37)16-20-13-9-6-10-14-20)32-27(35)24(18(3)4)31-25(33)21(29)15-19-11-7-5-8-12-19/h5-14,17-18,21-24H,15-16,29H2,1-4H3,(H,30,34)(H,31,33)(H,32,35)(H,36,37)/t21-,22+,23-,24+/m0/s1 |
| InChIKey | DEUGGGVTLCYZPU-UARRHKHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (31611414) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bilaid A (CHEBI:227354) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2R)-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 90606585 | ChemSpider |