EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:227349 - 3,5-dibromo-p-anisic acid
| Formula | C8H6Br2O3 |
| Net Charge | 0 |
| Average Mass | 309.941 |
| Monoisotopic Mass | 307.86837 |
| SMILES | COc1c(Br)cc(C(=O)O)cc1Br |
| InChI | InChI=1S/C8H6Br2O3/c1-13-7-5(9)2-4(8(11)12)3-6(7)10/h2-3H,1H3,(H,11,12) |
| InChIKey | NAHPGFGVWWKSFU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dibromo-p-anisic acid (CHEBI:227349) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 3,5-dibromo-4-methoxybenzoic acid |