EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27NO4 |
| Net Charge | 0 |
| Average Mass | 333.428 |
| Monoisotopic Mass | 333.19401 |
| SMILES | CCCCCCCCCC(=O)N/C(=C\c1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C19H27NO4/c1-2-3-4-5-6-7-8-9-18(22)20-17(19(23)24)14-15-10-12-16(21)13-11-15/h10-14,21H,2-9H2,1H3,(H,20,22)(H,23,24)/b17-14- |
| InChIKey | LCWMLAAWWWWZBR-VKAVYKQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Thalassotaleaspecies PP2-459 (ncbitaxon:1742724) | - | PubMed (26824128) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thalabetaotalic acid A (CHEBI:227321) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (Z)-2-(decanoylamino)-3-(4-hydroxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58196570 | ChemSpider |