EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34N5O6S |
| Net Charge | +1 |
| Average Mass | 508.621 |
| Monoisotopic Mass | 508.22243 |
| SMILES | CC(C)=CC(=O)NC1=CC(=O)[C@]2(C)[C@H](O)[C@@H](S(=O)C3=NCC(C[C@@H](C(=O)O)[N+](C)(C)C)=N3)[C@H](C)N12 |
| InChI | InChI=1S/C23H33N5O6S/c1-12(2)8-18(30)26-17-10-16(29)23(4)20(31)19(13(3)27(17)23)35(34)22-24-11-14(25-22)9-15(21(32)33)28(5,6)7/h8,10,13,15,19-20,31H,9,11H2,1-7H3,(H-,26,29,30,32,33)/p+1/t13-,15-,19-,20+,23+,35?/m0/s1 |
| InChIKey | SQDMOVIZORCYFG-JZOJLNEJSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspeciesnoverrucosus (ncbitaxon:284043) | - | PubMed (26024315) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spithioneine B (CHEBI:227277) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| [(1S)-1-carboxy-2-[2-[[(1S,2S,3S,8S)-1-hydroxy-3,8-dimethyl-5-(3-methylbut-2-enoylamino)-7-oxo-2,3-dihydro-1H-pyrrolizin-2-yl]sulinyl]-4H-imidazol-5-yl]ethyl]-trimethylazanium |