EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O8 |
| Net Charge | 0 |
| Average Mass | 322.269 |
| Monoisotopic Mass | 322.06887 |
| SMILES | COc1cc(O)c(C(=O)O)c(C(=C/C(=O)O)/C(C)=C\C(=O)O)c1 |
| InChI | InChI=1S/C15H14O8/c1-7(3-12(17)18)9(6-13(19)20)10-4-8(23-2)5-11(16)14(10)15(21)22/h3-6,16H,1-2H3,(H,17,18)(H,19,20)(H,21,22)/b7-3-,9-6+ |
| InChIKey | KGXDIJIFQJMADP-UZQZEERZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria alternata (ncbitaxon:5599) | - | DOI (10.1002/ejoc.201801801) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Altenuic acid IV (CHEBI:227238) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (2E,4Z)-3-(2-carboxy-3-hydroxy-5-methoxyphenyl)-4-methylhexa-2,4-dienedioic acid |