EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39NO6 |
| Net Charge | 0 |
| Average Mass | 473.610 |
| Monoisotopic Mass | 473.27774 |
| SMILES | CNc1ccc(C(=O)C[C@@H](O)[C@H](C)C[C@@H](C)[C@H](O)[C@H](C)/C=C/C=C/C=C/[C@H](O)CC(=O)O)cc1 |
| InChI | InChI=1S/C27H39NO6/c1-18(9-7-5-6-8-10-23(29)16-26(32)33)27(34)20(3)15-19(2)24(30)17-25(31)21-11-13-22(28-4)14-12-21/h5-14,18-20,23-24,27-30,34H,15-17H2,1-4H3,(H,32,33)/b6-5+,9-7+,10-8+/t18-,19-,20-,23+,24-,27-/m1/s1 |
| InChIKey | WUYVILXSKDFPJZ-VZFGNGLPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (26798949) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mohangic acid B (CHEBI:227235) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (3R,4E,6E,8E,10R,11S,12R,14R,15R)-3,11,15-trihydroxy-10,12,14-trimethyl-17-[4-(methylamino)phenyl]-17-oxoheptadeca-4,6,8-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58196544 | ChemSpider |