EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27N3O6 |
| Net Charge | 0 |
| Average Mass | 477.517 |
| Monoisotopic Mass | 477.18999 |
| SMILES | COC(=O)Nc1ccc(Cc2ccc(NC(=O)OC)c(Cc3ccc(NC(=O)OC)cc3)c2)cc1 |
| InChI | InChI=1S/C26H27N3O6/c1-33-24(30)27-21-9-4-17(5-10-21)14-19-8-13-23(29-26(32)35-3)20(16-19)15-18-6-11-22(12-7-18)28-25(31)34-2/h4-13,16H,14-15H2,1-3H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | KZFOSAHWGWCDDK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus (ncbitaxon:33178) | - | DOI (10.1002/ejoc.201900383) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asperteramide A (CHEBI:227233) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| methyl N-[2,4-bis[[4-(methoxycarbonylamino)phenyl]methyl]phenyl]carbamate |
| Manual Xrefs | Databases |
|---|---|
| 74849484 | ChemSpider |