EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37NO6 |
| Net Charge | 0 |
| Average Mass | 459.583 |
| Monoisotopic Mass | 459.26209 |
| SMILES | C[C@H](/C=C/C=C/C=C/[C@H](O)CC(=O)O)[C@@H](O)[C@H](C)C[C@@H](C)[C@H](O)CC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C26H37NO6/c1-17(8-6-4-5-7-9-22(28)15-25(31)32)26(33)19(3)14-18(2)23(29)16-24(30)20-10-12-21(27)13-11-20/h4-13,17-19,22-23,26,28-29,33H,14-16,27H2,1-3H3,(H,31,32)/b5-4+,8-6+,9-7+/t17-,18-,19-,22+,23-,26-/m1/s1 |
| InChIKey | BZNPBFDQMIZFAM-JOCHRXQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (26798949) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mohangic acid A (CHEBI:227229) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (3R,4E,6E,8E,10R,11S,12R,14R,15R)-17-(4-aminophenyl)-3,11,15-trihydroxy-10,12,14-trimethyl-17-oxoheptadeca-4,6,8-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58196543 | ChemSpider |