EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O5 |
| Net Charge | 0 |
| Average Mass | 268.309 |
| Monoisotopic Mass | 268.13107 |
| SMILES | CC(=O)[C@@H]1C[C@H](C(=O)O)[C@@]1(C)CCC=C(C)C(=O)O |
| InChI | InChI=1S/C14H20O5/c1-8(12(16)17)5-4-6-14(3)10(9(2)15)7-11(14)13(18)19/h5,10-11H,4,6-7H2,1-3H3,(H,16,17)(H,18,19)/t10-,11+,14-/m0/s1 |
| InChIKey | UDZRBDXBUYNBCW-WDMOLILDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichoderma harzianum (ncbitaxon:5544) | - | PubMed (30606673) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Harzianoic acid A (CHEBI:227223) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (1S,2S,3R)-3-acetyl-2-(4-carboxypent-3-enyl)-2-methylcyclobutane-1-carboxylic acid |