EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O5 |
| Net Charge | 0 |
| Average Mass | 358.434 |
| Monoisotopic Mass | 358.17802 |
| SMILES | C=Cc1c(C)cc(O)c2c1[C@H](O)[C@@H](O)[C@H]1[C@]23C[C@H]3CC[C@@]1(C)C(=O)OC |
| InChI | InChI=1S/C21H26O5/c1-5-12-10(2)8-13(22)15-14(12)16(23)17(24)18-20(3,19(25)26-4)7-6-11-9-21(11,15)18/h5,8,11,16-18,22-24H,1,6-7,9H2,2-4H3/t11-,16+,17-,18-,20-,21+/m1/s1 |
| InChIKey | MQEUTRGOTKQOBL-IKPCXWSHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthriniumspecies (ncbitaxon:1756131) | - | PubMed (21741249) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arthrinin D (CHEBI:227220) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| methyl (1R,8S,9S,10S,11R,14R)-6-ethenyl-3,8,9-trihydroxy-5,11-dimethyltetracyclo[8.5.0.01,14.02,7]pentadeca-2,4,6-triene-11-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 26633807 | ChemSpider |