EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22O5 |
| Net Charge | 0 |
| Average Mass | 258.314 |
| Monoisotopic Mass | 258.14672 |
| SMILES | CC[C@H](C[C@H]1CC[C@@H]([C@H](C)C(=O)O)O1)OC(C)=O |
| InChI | InChI=1S/C13H22O5/c1-4-10(17-9(3)14)7-11-5-6-12(18-11)8(2)13(15)16/h8,10-12H,4-7H2,1-3H3,(H,15,16)/t8-,10+,11+,12-/m0/s1 |
| InChIKey | FPPNINAJBFJBAS-GMNPVEAJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1016/j.phytol.2015.04.001) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-acetyl homononactic acid (CHEBI:227212) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (2S)-2-[(2S,5R)-5-[(2R)-2-acetyloxybutyl]oxolan-2-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 40256806 | ChemSpider |