EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O4 |
| Net Charge | 0 |
| Average Mass | 262.305 |
| Monoisotopic Mass | 262.12051 |
| SMILES | CC[C@H](/C=C(C)/C=C/c1ccc(C)c(=O)o1)C(=O)O |
| InChI | InChI=1S/C15H18O4/c1-4-12(14(16)17)9-10(2)5-7-13-8-6-11(3)15(18)19-13/h5-9,12H,4H2,1-3H3,(H,16,17)/b7-5+,10-9+/t12-/m1/s1 |
| InChIKey | VVFDSTJZTMWWEW-BBADGORWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium solitum (ncbitaxon:60172) | - | PubMed (25370608) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penipyrol A (CHEBI:227156) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2R,3E,5E)-2-ethyl-4-methyl-6-(5-methyl-6-oxopyran-2-yl)hexa-3,5-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 44210754 | ChemSpider |