EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H53N5O8 |
| Net Charge | 0 |
| Average Mass | 659.825 |
| Monoisotopic Mass | 659.38941 |
| SMILES | CCCCC[C@@H]1CC(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccccc2)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)O1 |
| InChI | InChI=1S/C34H53N5O8/c1-7-9-11-16-24-18-26(41)35-19-27(42)37-28(20(3)4)32(44)36-25(17-23-14-12-10-13-15-23)31(43)39-30(22(6)40)33(45)38-29(21(5)8-2)34(46)47-24/h10,12-15,20-22,24-25,28-30,40H,7-9,11,16-19H2,1-6H3,(H,35,41)(H,36,44)(H,37,42)(H,38,45)(H,39,43)/t21-,22+,24+,25+,28-,29-,30-/m0/s1 |
| InChIKey | HGPXRBNTPJNLNZ-XFMXPLRXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Photorhabdus (ncbitaxon:29487) | - | PubMed (31814269) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phototemtide A (CHEBI:227107) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6S,9R,12S,19R)-9-benzyl-3-[(2S)-butan-2-yl]-6-[(1R)-1-hydroxyethyl]-19-pentyl-12-propan-2-yl-1-oxa-4,7,10,13,16-pentazacyclononadecane-2,5,8,11,14,17-hexone |