EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO4 |
| Net Charge | 0 |
| Average Mass | 197.190 |
| Monoisotopic Mass | 197.06881 |
| SMILES | COC(=O)c1ccc(OC)c(O)c1N |
| InChI | InChI=1S/C9H11NO4/c1-13-6-4-3-5(9(12)14-2)7(10)8(6)11/h3-4,11H,10H2,1-2H3 |
| InChIKey | QBGAIEVOBDWSRU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Micrococcus (ncbitaxon:1269) | - | PubMed (19388705) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-3-hydroxy-4-methoxybenzoic acid methyl ester (CHEBI:227063) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| methyl 2-amino-3-hydroxy-4-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 24622054 | ChemSpider |