EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H59ClO7 |
| Net Charge | 0 |
| Average Mass | 663.336 |
| Monoisotopic Mass | 662.39493 |
| SMILES | CCCCC(Cl)CCCC[C@H](C)[C@@H](O)c1cc(O)c([C@@H](CCCC)CCCC[C@H](C)[C@@H](OC(C)=O)c2cc(O)cc(O)c2)c(O)c1 |
| InChI | InChI=1S/C38H59ClO7/c1-6-8-16-28(17-12-10-15-26(4)38(46-27(5)40)30-20-32(41)24-33(42)21-30)36-34(43)22-29(23-35(36)44)37(45)25(3)14-11-13-19-31(39)18-9-7-2/h20-26,28,31,37-38,41-45H,6-19H2,1-5H3/t25-,26-,28-,31?,37+,38+/m0/s1 |
| InChIKey | OALOPYYRKWCJGW-KIWBYYFGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cylindrospermum stagnale PCC 7417 (ncbitaxon:56107) | - | PubMed (26684177) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cylindrofridin B (CHEBI:227053) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| [(1R,2S,7S)-7-[4-[(1R,2S)-7-chloro-1-hydroxy-2-methylundecyl]-2,6-dihydroxyphenyl]-1-(3,5-dihydroxyphenyl)-2-methylundecyl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 58915006 | ChemSpider |