EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H62N6O7S |
| Net Charge | 0 |
| Average Mass | 698.972 |
| Monoisotopic Mass | 698.44007 |
| SMILES | CC[C@H](C)[C@@H](C(=O)NC)N(C)C(=O)[C@@H](NC(=O)[C@H](C(C)C)N(C)C(=O)[C@H]([C@@H](C)CC)N(C)C(=O)[C@H](C)N(C)C(=O)/C=C/S(C)=O)C(C)C |
| InChI | InChI=1S/C34H62N6O7S/c1-16-22(7)28(30(42)35-10)39(13)33(45)26(20(3)4)36-31(43)27(21(5)6)38(12)34(46)29(23(8)17-2)40(14)32(44)24(9)37(11)25(41)18-19-48(15)47/h18-24,26-29H,16-17H2,1-15H3,(H,35,42)(H,36,43)/b19-18+/t22-,23-,24-,26-,27-,28-,29-,48?/m0/s1 |
| InChIKey | VJHQQCCKXFLKLU-QZFMFPMKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pterulaspecies (ncbitaxon:2040936) | - | PubMed (17067148) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pterulamide I (CHEBI:227009) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S,3S)-N,3-dimethyl-2-[methyl-[(2S)-3-methyl-2-[[(2S)-3-methyl-2-[methyl-[(2S,3S)-3-methyl-2-[methyl-[(2S)-2-[methyl-[(E)-3-methylsulinylprop-2-enoyl]amino]propanoyl]amino]pentanoyl]amino]butanoyl]amino]butanoyl]amino]pentanamide |
| Manual Xrefs | Databases |
|---|---|
| 17250095 | ChemSpider |