EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16O5 |
| Net Charge | 0 |
| Average Mass | 228.244 |
| Monoisotopic Mass | 228.09977 |
| SMILES | C=C(C(=O)O)[C@H](CCCCC(C)=O)C(=O)O |
| InChI | InChI=1S/C11H16O5/c1-7(12)5-3-4-6-9(11(15)16)8(2)10(13)14/h9H,2-6H2,1H3,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | IGSGZWAWTKVRCR-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (29973682) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asperitaconic acid C (CHEBI:227007) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| (3S)-2-methylidene-3-(5-oxohexyl)butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048470 | ChemSpider |