EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20N4O7S |
| Net Charge | 0 |
| Average Mass | 376.391 |
| Monoisotopic Mass | 376.10527 |
| SMILES | CN1C=C(C(N)=O)[C@@H]2C[C@H](O)[C@@](NC(=O)CS(N)(=O)=O)(C(=O)O)[C@@H]2C1 |
| InChI | InChI=1S/C13H20N4O7S/c1-17-3-7(11(14)20)6-2-9(18)13(12(21)22,8(6)4-17)16-10(19)5-25(15,23)24/h3,6,8-9,18H,2,4-5H2,1H3,(H2,14,20)(H,16,19)(H,21,22)(H2,15,23,24)/t6-,8+,9-,13+/m0/s1 |
| InChIKey | VZRFZUPFQKSXPV-VPFIQFBESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (2584138) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Altemicidin (CHEBI:227005) is a N-acyl-L-amino acid (CHEBI:21644) |
| Altemicidin (CHEBI:227005) is conjugate acid of altemicidin(1−) (CHEBI:232089) |
| Incoming Relation(s) |
| altemicidin(1−) (CHEBI:232089) is conjugate base of Altemicidin (CHEBI:227005) |
| IUPAC Name |
|---|
| (4aR,6S,7R,7aS)-4-carbamoyl-6-hydroxy-2-methyl-7-[(2-sulamoylacetyl)amino]-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyridine-7-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 9211348 | ChemSpider |