EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:226947 - 18-bromooctadeca-5,7,17-triynoic acid
| Formula | C18H23BrO2 |
| Net Charge | 0 |
| Average Mass | 351.284 |
| Monoisotopic Mass | 350.08814 |
| SMILES | O=C(O)CCCC#CC#CCCCCCCCCC#CBr |
| InChI | InChI=1S/C18H23BrO2/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(20)21/h1-3,5,7,9,11-14,16H2,(H,20,21) |
| InChIKey | PMILLCBGPQOPQV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acarospora (ncbitaxon:88747) | - | DOI (10.1016/s0031-9422(98)00499-3) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-bromooctadeca-5,7,17-triynoic acid (CHEBI:226947) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 18-bromooctadeca-5,7,17-triynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78434944 | ChemSpider |
| LMFA01090088 | LIPID MAPS |