EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O8 |
| Net Charge | 0 |
| Average Mass | 348.307 |
| Monoisotopic Mass | 348.08452 |
| SMILES | COC(=O)c1cc(OC)c2c3c1OC(C)=CC(O)=C3[C@@H](OC)OC2=O |
| InChI | InChI=1S/C17H16O8/c1-7-5-9(18)11-13-12(16(20)25-17(11)23-4)10(21-2)6-8(14(13)24-7)15(19)22-3/h5-6,17-18H,1-4H3/t17-/m0/s1 |
| InChIKey | ARPKIESCUHOTPR-KRWDZBQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Graphis proserpens (ncbitaxon:996888) | - | PubMed (21612806) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Proserin C (CHEBI:226875) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| methyl 13-hydroxy-2,6-dimethoxy-11-methyl-4-oxo-3,10-dioxatricyclo[7.4.1.05,14]tetradeca-1(13),5,7,9(14),11-pentaene-8-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78435067 | ChemSpider |