EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H72MgN4O6 |
| Net Charge | 0 |
| Average Mass | 909.508 |
| Monoisotopic Mass | 908.53023 |
| SMILES | [H]C(C)=C1C2=[N+]3C(=Cc4c(C(C)=O)c(C)c5[n]4[Mg-2]34[n]3c(c(C)c6c3=C(C3=[N+]4C(=C5)[C@@H](C)[C@@H]3CCC(=O)OC/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@@H](C(=O)OC)C6=O)=C2)C1C |
| InChI | InChI=1S/C55H73N4O6.Mg/c1-13-39-34(7)41-29-46-48(38(11)60)36(9)43(57-46)27-42-35(8)40(52(58-42)50-51(55(63)64-12)54(62)49-37(10)44(59-53(49)50)28-45(39)56-41)23-24-47(61)65-26-25-33(6)22-16-21-32(5)20-15-19-31(4)18-14-17-30(2)3;/h13,25,27-32,34-35,40,51H,14-24,26H2,1-12H3,(H-,56,57,58,59,60,62);/q-1;+2/p-1/b33-25+,39-13?;/t31-,32-,34?,35+,40+,51-;/m1./s1 |
| InChIKey | IOOQHEFLQLMYPZ-GXOKMSFHSA-M |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bacteriochlorophyll b (CHEBI:22686) is a bacteriochlorophyll (CHEBI:38201) |
| bacteriochlorophyll b (CHEBI:22686) is a methyl ester (CHEBI:25248) |
| Incoming Relation(s) |
| (7R,8Z)-bacteriochlorophyll b (CHEBI:30034) is a bacteriochlorophyll b (CHEBI:22686) |
| Synonym | Source |
|---|---|
| bacteriochlorophyll b | JCBN |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1208904 | Beilstein |