EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42N2O9 |
| Net Charge | 0 |
| Average Mass | 562.660 |
| Monoisotopic Mass | 562.28903 |
| SMILES | CCC(C)CCC[C@H]1C(=O)O[C@H](C)[C@H](NC(=O)c2cccc(NC=O)c2O)C(=O)O[C@@H](C)[C@@H]1OC(=O)C(C)CC |
| InChI | InChI=1S/C29H42N2O9/c1-7-16(3)11-9-13-21-25(40-27(35)17(4)8-2)19(6)39-29(37)23(18(5)38-28(21)36)31-26(34)20-12-10-14-22(24(20)33)30-15-32/h10,12,14-19,21,23,25,33H,7-9,11,13H2,1-6H3,(H,30,32)(H,31,34)/t16?,17?,18-,19+,21-,23+,25+/m1/s1 |
| InChIKey | QYJNUSICZJHTEF-NOACVWJBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (16161485) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Antimycin A10 (CHEBI:226854) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| [(2R,3S,6S,7R,8R)-3-[(3-ormamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-8-(4-methylhexyl)-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylbutanoate |
| Manual Xrefs | Databases |
|---|---|
| 9482512 | ChemSpider |