EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O2 |
| Net Charge | 0 |
| Average Mass | 204.229 |
| Monoisotopic Mass | 204.08988 |
| SMILES | CO[C@H]1C=C(c2ccccc2N)C(=O)N1 |
| InChI | InChI=1S/C11H12N2O2/c1-15-10-6-8(11(14)13-10)7-4-2-3-5-9(7)12/h2-6,10H,12H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | UHOSDVKGUPVFLL-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rapidithrix thailandica (ncbitaxon:413964) | - | PubMed (24162950) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(2-amino-phenyl)-5-methoxy-1,5-dihydro-pyrrol-2-one (CHEBI:226853) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-(2-aminophenyl)-2-methoxy-1,2-dihydropyrrol-5-one |
| Manual Xrefs | Databases |
|---|---|
| 32674788 | ChemSpider |