EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38N4O6 |
| Net Charge | 0 |
| Average Mass | 490.601 |
| Monoisotopic Mass | 490.27913 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(C)C)C(=O)O |
| InChI | InChI=1S/C25H38N4O6/c1-14(2)12-19(25(34)35)27-23(32)20-6-5-11-29(20)24(33)21(15(3)4)28-22(31)18(26)13-16-7-9-17(30)10-8-16/h7-10,14-15,18-21,30H,5-6,11-13,26H2,1-4H3,(H,27,32)(H,28,31)(H,34,35)/t18-,19-,20-,21-/m0/s1 |
| InChIKey | RITYBYCZDREYDS-TUFLPTIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudoalteromonas haloplanktis (ncbitaxon:228) | - | PubMed (15988629) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| l-tyrosyl-l-valyl-l-prolyl-l-leucine (CHEBI:226842) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 10480961 | ChemSpider |