EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11ClO4 |
| Net Charge | 0 |
| Average Mass | 242.658 |
| Monoisotopic Mass | 242.03459 |
| SMILES | Cc1c(O)c(Cl)c2c(c1O)C(=O)O[C@@H](C)C2 |
| InChI | InChI=1S/C11H11ClO4/c1-4-3-6-7(11(15)16-4)9(13)5(2)10(14)8(6)12/h4,13-14H,3H2,1-2H3/t4-/m0/s1 |
| InChIKey | SWPQOYCPQGXBPF-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomiumspecies (ncbitaxon:1769349) | - | PubMed (29662118) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chaetosemin G (CHEBI:226800) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3S)-5-chloro-6,8-dihydroxy-3,7-dimethyl-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 78441600 | ChemSpider |