EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N2O3 |
| Net Charge | 0 |
| Average Mass | 290.363 |
| Monoisotopic Mass | 290.16304 |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C16H22N2O3/c1-12(20)17-15(10-13-6-3-2-4-7-13)16(21)18-9-5-8-14(18)11-19/h2-4,6-7,14-15,19H,5,8-11H2,1H3,(H,17,20)/t14-,15-/m0/s1 |
| InChIKey | IIXXOKNZZNVVTK-GJZGRUSLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tolypocladium (ncbitaxon:29909) | - | PubMed (29563600) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tolyprolinol (CHEBI:226775) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-[(2S)-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]acetamide |
| Manual Xrefs | Databases |
|---|---|
| 67176158 | ChemSpider |