EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H52O7 |
| Net Charge | 0 |
| Average Mass | 572.783 |
| Monoisotopic Mass | 572.37130 |
| SMILES | CC(=O)OC[C@]12CC[C@H](O)C(C)(C)[C@@H]1CCC1=C2CC[C@]2(C)[C@@H]([C@H](C)[C@H](C/C=C(/C)C(=O)O)OC(C)=O)CC[C@@]12C |
| InChI | InChI=1S/C34H52O7/c1-20(30(38)39)9-11-27(41-23(4)36)21(2)24-13-16-33(8)25-10-12-28-31(5,6)29(37)15-18-34(28,19-40-22(3)35)26(25)14-17-32(24,33)7/h9,21,24,27-29,37H,10-19H2,1-8H3,(H,38,39)/b20-9-/t21-,24+,27-,28-,29-,32+,33-,34-/m0/s1 |
| InChIKey | UKKPVKLMFXKBEK-GACQTQHGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma colossus (ncbitaxon:36070) | - | PubMed (32639735) |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganocolobetausin G (CHEBI:226766) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (Z,5S,6S)-5-acetyloxy-6-[(3S,5R,10R,13R,14R,17R)-10-(acetyloxymethyl)-3-hydroxy-4,4,13,14-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |