EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40N4O5 |
| Net Charge | 0 |
| Average Mass | 512.651 |
| Monoisotopic Mass | 512.29987 |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCCN2C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C28H40N4O5/c1-3-21(33)14-8-5-9-15-22-26(35)29-19(2)25(34)31-23(18-20-12-6-4-7-13-20)28(37)32-17-11-10-16-24(32)27(36)30-22/h4,6-7,12-13,19,22-24H,3,5,8-11,14-18H2,1-2H3,(H,29,35)(H,30,36)(H,31,34)/t19-,22-,23-,24+/m0/s1 |
| InChIKey | DEUCVOIWOGPZGS-ZNEWLNCYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microsporum (ncbitaxon:34392) | - | DOI (10.1016/j.tet.2007.04.025) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microsporin A (CHEBI:226740) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (3S,6S,9S,12R)-3-benzyl-6-methyl-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 23076377 | ChemSpider |