EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N2O4S |
| Net Charge | 0 |
| Average Mass | 378.494 |
| Monoisotopic Mass | 378.16133 |
| SMILES | COc1cc(C(=O)O)nc(-c2csc(CCCCCC(C)C)n2)c1OC |
| InChI | InChI=1S/C19H26N2O4S/c1-12(2)8-6-5-7-9-16-20-14(11-26-16)17-18(25-4)15(24-3)10-13(21-17)19(22)23/h10-12H,5-9H2,1-4H3,(H,22,23) |
| InChIKey | FTINOJZJQDYDFI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lentzea (ncbitaxon:165301) | - | PubMed (29515230) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyrizomicin B (CHEBI:226738) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| IUPAC Name |
|---|
| 4,5-dimethoxy-6-[2-(6-methylheptyl)-1,3-thiazol-4-yl]pyridine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435224 | ChemSpider |