EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O9 |
| Net Charge | 0 |
| Average Mass | 412.435 |
| Monoisotopic Mass | 412.17333 |
| SMILES | COc1cc(C(=O)O)cc(CC=C(C)C)c1O[C@@H]1O[C@H](CO)[C@@H](OC)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H28O9/c1-10(2)5-6-11-7-12(19(24)25)8-13(26-3)17(11)29-20-16(23)15(22)18(27-4)14(9-21)28-20/h5,7-8,14-16,18,20-23H,6,9H2,1-4H3,(H,24,25)/t14-,15-,16-,18-,20+/m1/s1 |
| InChIKey | CNVGIUXDEAHMTH-RDLFHWDQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Conoideocrella (ncbitaxon:1105318) | - | DOI (10.1016/j.tet.2019.05.007) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Conoideoglucoside C (CHEBI:226737) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 4-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxy-3-methoxy-5-(3-methylbut-2-enyl)benzoic acid |