EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O4 |
| Net Charge | 0 |
| Average Mass | 466.662 |
| Monoisotopic Mass | 466.30831 |
| SMILES | CC1=CC[C@@H]([C@@H](C)[C@H]2CC[C@@]3(C)C4=C(CC[C@]23C)[C@]23CC[C@@H](OC2=O)C(C)(C)[C@@H]3CC4)OC1=O |
| InChI | InChI=1S/C30H42O4/c1-17-7-9-22(33-25(17)31)18(2)19-11-14-29(6)20-8-10-23-27(3,4)24-13-16-30(23,26(32)34-24)21(20)12-15-28(19,29)5/h7,18-19,22-24H,8-16H2,1-6H3/t18-,19+,22-,23-,24+,28+,29-,30-/m0/s1 |
| InChIKey | AEHQRZIZRASHSX-PNLPGUNJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma colossus (ncbitaxon:36070) | - | PubMed (32639735) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganodermalactone W (CHEBI:226728) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (1R,5R,6R,9R,13S,15R)-5,9,14,14-tetramethyl-6-[(1S)-1-[(2S)-5-methyl-6-oxo-2,3-dihydropyran-2-yl]ethyl]-16-oxapentacyclo[13.2.2.01,13.02,10.05,9]nonadec-2(10)-en-17-one |