EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N6O7 |
| Net Charge | 0 |
| Average Mass | 442.388 |
| Monoisotopic Mass | 442.12370 |
| SMILES | Cn1c(=O)c2nc(C(=O)N[C@@H](CO)C(=O)Nc3ccccc3C(=O)O)cnc2n(C)c1=O |
| InChI | InChI=1S/C19H18N6O7/c1-24-14-13(17(29)25(2)19(24)32)21-11(7-20-14)15(27)23-12(8-26)16(28)22-10-6-4-3-5-9(10)18(30)31/h3-7,12,26H,8H2,1-2H3,(H,22,28)(H,23,27)(H,30,31)/t12-/m0/s1 |
| InChIKey | SWKVVWQFYYWCRZ-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (32568536) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penilumamide H (CHEBI:226702) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 2-[[(2S)-2-[(1,3-dimethyl-2,4-dioxopteridine-6-carbonyl)amino]-3-hydroxypropanoyl]amino]benzoic acid |