EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N6O6 |
| Net Charge | 0 |
| Average Mass | 426.389 |
| Monoisotopic Mass | 426.12878 |
| SMILES | C[C@H](NC(=O)c1cnc2c(n1)c(=O)n(C)c(=O)n2C)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C19H18N6O6/c1-9(15(26)23-11-7-5-4-6-10(11)18(29)30)21-16(27)12-8-20-14-13(22-12)17(28)25(3)19(31)24(14)2/h4-9H,1-3H3,(H,21,27)(H,23,26)(H,29,30)/t9-/m0/s1 |
| InChIKey | TXBKQFKAVRJHRT-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (32568536) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penilumamide G (CHEBI:226697) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 2-[[(2S)-2-[(1,3-dimethyl-2,4-dioxopteridine-6-carbonyl)amino]propanoyl]amino]benzoic acid |