EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42N6O5 |
| Net Charge | 0 |
| Average Mass | 542.681 |
| Monoisotopic Mass | 542.32167 |
| SMILES | C/C=C1/CN(C(=O)[C@H](CCCCNC(=N)N)NC(=O)c2ccccc2)C(C(=O)N[C@@H](CC(C)C)C(=O)O)[C@@H]1C |
| InChI | InChI=1S/C28H42N6O5/c1-5-19-16-34(23(18(19)4)25(36)33-22(27(38)39)15-17(2)3)26(37)21(13-9-10-14-31-28(29)30)32-24(35)20-11-7-6-8-12-20/h5-8,11-12,17-18,21-23H,9-10,13-16H2,1-4H3,(H,32,35)(H,33,36)(H,38,39)(H4,29,30,31)/b19-5-/t18-,21+,22+,23?/m1/s1 |
| InChIKey | BJWAMDSUOTWAAR-ARFAWJGJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsis lucentensis (ncbitaxon:53441) | - | PubMed (17630797) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lucentamycin A (CHEBI:226695) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(3R,4E)-1-[(2S)-2-benzamido-6-(diaminomethylideneamino)hexanoyl]-4-ethylidene-3-methylpyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid |