EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N7O4 |
| Net Charge | 0 |
| Average Mass | 407.390 |
| Monoisotopic Mass | 407.13420 |
| SMILES | [C-]#[N+]c1ccccc1NC(=O)[C@H](C)NC(=O)c1cnc2c(n1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C19H17N7O4/c1-10(16(27)24-12-8-6-5-7-11(12)20-2)22-17(28)13-9-21-15-14(23-13)18(29)26(4)19(30)25(15)3/h5-10H,1,3-4H3,(H,22,28)(H,24,27)/t10-/m0/s1 |
| InChIKey | GVDFPWXMJVSFAE-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (32568536) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penilumamide F (CHEBI:226692) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-[(2S)-1-(2-isocyanoanilino)-1-oxopropan-2-yl]-1,3-dimethyl-2,4-dioxopteridine-6-carboxamide |