EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O6 |
| Net Charge | 0 |
| Average Mass | 444.568 |
| Monoisotopic Mass | 444.25119 |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C[C@]12O[C@H]1C(=O)C(COC(=O)C[C@H](C)O)=CC2=O |
| InChI | InChI=1S/C26H36O6/c1-15-7-8-19-24(3,4)9-6-10-25(19,5)18(15)13-26-20(28)12-17(22(30)23(26)32-26)14-31-21(29)11-16(2)27/h12,16,18-19,23,27H,1,6-11,13-14H2,2-5H3/t16-,18-,19-,23-,25+,26+/m0/s1 |
| InChIKey | MUDDAWRRLBXWPU-DYNITIQCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichodermaspecies 1212-03 (ncbitaxon:1421414) | - | DOI (10.1016/j.tet.2019.04.018) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-deoxyneomacrophorin IV (CHEBI:226686) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| [(1R,6S)-6-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]methyl (3S)-3-hydroxybutanoate |