EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9ClO4 |
| Net Charge | 0 |
| Average Mass | 228.631 |
| Monoisotopic Mass | 228.01894 |
| SMILES | C[C@@H]1OC(=O)c2c(O)cc(O)cc2[C@@H]1Cl |
| InChI | InChI=1S/C10H9ClO4/c1-4-9(11)6-2-5(12)3-7(13)8(6)10(14)15-4/h2-4,9,12-13H,1H3/t4-,9+/m0/s1 |
| InChIKey | WYUIOVYIGXNMKO-AJAUBTJJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lachnum (ncbitaxon:47817) | - | PubMed (7730162) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-chloro-6-hydroxymellein (CHEBI:226639) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3S,4S)-4-chloro-6,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 78436203 | ChemSpider |