EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34N6O5 |
| Net Charge | 0 |
| Average Mass | 462.551 |
| Monoisotopic Mass | 462.25907 |
| SMILES | C[C@@H]1NC(=O)[C@H](CCCN)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@H](CCCN)NC1=O |
| InChI | InChI=1S/C22H34N6O5/c1-13-19(30)26-17(5-3-11-24)21(32)28-18(12-14-6-8-15(29)9-7-14)22(33)27-16(4-2-10-23)20(31)25-13/h6-9,13,16-18,29H,2-5,10-12,23-24H2,1H3,(H,25,31)(H,26,30)(H,27,33)(H,28,32)/t13-,16-,17-,18-/m0/s1 |
| InChIKey | KBVNEBGZKSSKBI-MGHWNKPDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomyces (ncbitaxon:1654) | - | PubMed (23859601) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,6S,9S,12S)-3,9-bis(3-aminopropyl)-6-[(4-hydroxyphenyl)methyl]-12-methyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone (CHEBI:226630) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3S,6S,9S,12S)-3,9-bis(3-aminopropyl)-6-[(4-hydroxyphenyl)methyl]-12-methyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 78438352 | ChemSpider |