EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28N4O4 |
| Net Charge | 0 |
| Average Mass | 436.512 |
| Monoisotopic Mass | 436.21106 |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@](C)(NC(=O)[C@@H]2C=C3c4cccc5ncc(c45)C[C@H]3N(C)C2)OC1=O |
| InChI | InChI=1S/C24H28N4O4/c1-12(2)20-22(30)32-24(3,23(31)26-20)27-21(29)14-8-16-15-6-5-7-17-19(15)13(10-25-17)9-18(16)28(4)11-14/h5-8,10,12,14,18,20,25H,9,11H2,1-4H3,(H,26,31)(H,27,29)/t14-,18-,20+,24+/m1/s1 |
| InChIKey | SJBHTLCEMGAZPJ-MBQSRQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Claviceps purpurea (ncbitaxon:5111) | - | DOI (10.1271/bbb1924.23.246) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ergosecaline (CHEBI:226624) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (6aR,9R)-7-methyl-N-[(2S,5S)-2-methyl-3,6-dioxo-5-propan-2-ylmorpholin-2-yl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-g]quinoline-9-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 78437812 | ChemSpider |