EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O7 |
| Net Charge | 0 |
| Average Mass | 318.281 |
| Monoisotopic Mass | 318.07395 |
| SMILES | COC(=O)c1cc(OC)c2c3c1OC(C)=CC(O)=C3COC2=O |
| InChI | InChI=1S/C16H14O7/c1-7-4-10(17)9-6-22-16(19)13-11(20-2)5-8(15(18)21-3)14(23-7)12(9)13/h4-5,17H,6H2,1-3H3 |
| InChIKey | UOZNHTRGIJZLAD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Graphis proserpens (ncbitaxon:996888) | - | PubMed (21612806) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Proserin A (CHEBI:226590) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| methyl 13-hydroxy-6-methoxy-11-methyl-4-oxo-3,10-dioxatricyclo[7.4.1.05,14]tetradeca-1(13),5,7,9(14),11-pentaene-8-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 28288848 | ChemSpider |