EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O6 |
| Net Charge | 0 |
| Average Mass | 320.341 |
| Monoisotopic Mass | 320.12599 |
| SMILES | C=C1OC(=O)[C@@]2([C@H](/C=C/C=C/C)C=C[C@H](OC(C)=O)[C@@H]2O)[C@H]1O |
| InChI | InChI=1S/C17H20O6/c1-4-5-6-7-12-8-9-13(23-11(3)18)15(20)17(12)14(19)10(2)22-16(17)21/h4-9,12-15,19-20H,2H2,1,3H3/b5-4+,7-6+/t12-,13+,14+,15+,17+/m1/s1 |
| InChIKey | QDKWUNFAPAGADH-FWBHNOMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium (ncbitaxon:5506) | - | DOI (10.1016/j.tet.2019.01.052) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusaspirol B (CHEBI:226580) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| [(4R,5R,6R,7S,10R)-4,6-dihydroxy-3-methylidene-1-oxo-10-[(1E,3E)-penta-1,3-dienyl]-2-oxaspiro[4.5]dec-8-en-7-yl] acetate |