EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H18O12 |
| Net Charge | 0 |
| Average Mass | 558.451 |
| Monoisotopic Mass | 558.07983 |
| SMILES | COc1cc(O)c2c(c1)[C@@]1(OC2=O)C(C)=CC(=O)[C@]12C(O)=c1c(=O)c(O)cc3oc(O)c4c(=O)cc(OC)c2c4c13 |
| InChI | InChI=1S/C29H18O12/c1-9-4-17(33)28(29(9)11-5-10(38-2)6-12(30)18(11)27(37)41-29)23-16(39-3)7-13(31)19-21(23)20-15(40-26(19)36)8-14(32)24(34)22(20)25(28)35/h4-8,30,32,35-36H,1-3H3/t28-,29-/m0/s1 |
| InChIKey | JZRVHFKTEMJGIG-VMPREFPWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces verruculosus (ncbitaxon:198730) | - | PubMed (24332629) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Verrulactone C (CHEBI:226559) is a phenanthrenes (CHEBI:25961) |
| Manual Xrefs | Databases |
|---|---|
| 78441437 | ChemSpider |