EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O7 |
| Net Charge | 0 |
| Average Mass | 398.411 |
| Monoisotopic Mass | 398.13655 |
| SMILES | COc1cc(O)c2c(c1)C(=O)C1=C(C2=O)[C@H](OC[C@@H]2C(=O)CC[C@H]2C)OC(C)=C1 |
| InChI | InChI=1S/C22H22O7/c1-10-4-5-16(23)15(10)9-28-22-19-13(6-11(2)29-22)20(25)14-7-12(27-3)8-17(24)18(14)21(19)26/h6-8,10,15,22,24H,4-5,9H2,1-3H3/t10-,15+,22-/m1/s1 |
| InChIKey | LXWOVDUGPWAOIU-KNSQMQPBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ulospora bilgramii (ncbitaxon:372062) | - | PubMed (32394716) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1R, 4′R, 5′R-ulosporin G (CHEBI:226522) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| (1R)-9-hydroxy-7-methoxy-3-methyl-1-[[(1R,2R)-2-methyl-5-oxocyclopentyl]methoxy]-1H-benzo[g]isochromene-5,10-dione |