EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H33N7O5S2 |
| Net Charge | 0 |
| Average Mass | 527.673 |
| Monoisotopic Mass | 527.19846 |
| SMILES | CSCC[C@H](NC(=O)c1csc([C@@H]2CCCN2C(=O)[C@H](CCCN=C(N)N)NC(C)=O)n1)C(=O)O |
| InChI | InChI=1S/C21H33N7O5S2/c1-12(29)25-13(5-3-8-24-21(22)23)19(31)28-9-4-6-16(28)18-27-15(11-35-18)17(30)26-14(20(32)33)7-10-34-2/h11,13-14,16H,3-10H2,1-2H3,(H,25,29)(H,26,30)(H,32,33)(H4,22,23,24)/t13-,14-,16-/m0/s1 |
| InChIKey | AFLLGKMKWFZARJ-DZKIICNBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas entomophila L48 (ncbitaxon:384676) | - | PubMed (31693786) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pseudotetratide A (CHEBI:226493) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S)-2-[[2-[(2S)-1-[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl]amino]-4-methylsulanylbutanoic acid |