EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H71N11O20 |
| Net Charge | 0 |
| Average Mass | 1026.065 |
| Monoisotopic Mass | 1025.48768 |
| SMILES | CCCCCCCCCCC[C@@H](O)CC(=O)NCC(=O)N[C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](C(=O)N[C@H](CCCN(O)N=O)C(=O)N[C@@H](CO)C(=O)N[C@H](CCCN(O)N=O)C(=O)O)[C@@H](C)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C40H71N11O20/c1-3-4-5-6-7-8-9-10-11-14-24(55)19-29(56)41-20-30(57)46-32(33(58)40(66)67)38(63)45-28(22-53)36(61)47-31(23(2)54)37(62)42-25(15-12-17-50(70)48-68)34(59)44-27(21-52)35(60)43-26(39(64)65)16-13-18-51(71)49-69/h23-28,31-33,52-55,58,70-71H,3-22H2,1-2H3,(H,41,56)(H,42,62)(H,43,60)(H,44,59)(H,45,63)(H,46,57)(H,47,61)(H,64,65)(H,66,67)/t23-,24-,25-,26-,27+,28+,31-,32-,33-/m1/s1 |
| InChIKey | NQISQRLTUDYJNV-SRCHHBQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraburkholderia megapolitana (ncbitaxon:420953) | - | PubMed (31276269) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Megapolibactin F (CHEBI:226482) is a peptide (CHEBI:16670) |